2-(Difluoromethyl)-4-fluoro-6-methylpyridine-3-carbonyl chloride
Modify Date: 2025-09-09 18:48:18
2-(Difluoromethyl)-4-fluoro-6-methylpyridine-3-carbonyl chloride structure
|
Common Name | 2-(Difluoromethyl)-4-fluoro-6-methylpyridine-3-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 1807157-52-3 | Molecular Weight | 223.58 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5ClF3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(Difluoromethyl)-4-fluoro-6-methylpyridine-3-carbonyl chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H5ClF3NO |
|---|---|
| Molecular Weight | 223.58 |
| InChIKey | CHRNSTBSBQNRMJ-UHFFFAOYSA-N |
| SMILES | Cc1cc(F)c(C(=O)Cl)c(C(F)F)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(Difluoromethyl)-4-fluoro-6-methylpyridine-3-carbonyl chloride? |
| A: CAS number of 2-(Difluoromethyl)-4-fluoro-6-methylpyridine-3-carbonyl chloride is 1807157-52-3. |
| Q: What is the English name of 2-(Difluoromethyl)-4-fluoro-6-methylpyridine-3-carbonyl chloride? |
| A: The English name of 2-(Difluoromethyl)-4-fluoro-6-methylpyridine-3-carbonyl chloride is 2-(Difluoromethyl)-4-fluoro-6-methylpyridine-3-carbonyl chloride. |
| Q: What is the SMILES notation of 2-(Difluoromethyl)-4-fluoro-6-methylpyridine-3-carbonyl chloride? |
| A: SMILES notation of 2-(Difluoromethyl)-4-fluoro-6-methylpyridine-3-carbonyl chloride is Cc1cc(F)c(C(=O)Cl)c(C(F)F)n1. |
| Q: What is the Chinese name of 1807157-52-3? |
| A: Chinese name of 1807157-52-3 is 1807157-52-3. |
| Q: What is the molecular weight of 2-(Difluoromethyl)-4-fluoro-6-methylpyridine-3-carbonyl chloride? |
| A: Molecular weight of 2-(Difluoromethyl)-4-fluoro-6-methylpyridine-3-carbonyl chloride is 223.58. |
| Q: What is the InChIKey of 2-(Difluoromethyl)-4-fluoro-6-methylpyridine-3-carbonyl chloride? |
| A: InChIKey of 2-(Difluoromethyl)-4-fluoro-6-methylpyridine-3-carbonyl chloride is CHRNSTBSBQNRMJ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-(Difluoromethyl)-4-fluoro-6-methylpyridine-3-carbonyl chloride? |
| A: Molecular formula of 2-(Difluoromethyl)-4-fluoro-6-methylpyridine-3-carbonyl chloride is C8H5ClF3NO. |