Benzoic acid, 2-cyano-3-fluoro-6-formyl
Modify Date: 2026-07-11 05:57:45
Benzoic acid, 2-cyano-3-fluoro-6-formyl structure
|
Common Name | Benzoic acid, 2-cyano-3-fluoro-6-formyl | ||
|---|---|---|---|---|
| CAS Number | 1807193-70-9 | Molecular Weight | 193.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H4FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzoic acid, 2-cyano-3-fluoro-6-formyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H4FNO3 |
|---|---|
| Molecular Weight | 193.13 |
| InChIKey | NEQDLKXKEXRTEK-UHFFFAOYSA-N |
| SMILES | N#Cc1c(F)ccc(C=O)c1C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Benzoic acid, 2-cyano-3-fluoro-6-formyl? |
| A: Molecular weight of Benzoic acid, 2-cyano-3-fluoro-6-formyl is 193.13. |
| Q: What is the InChIKey of Benzoic acid, 2-cyano-3-fluoro-6-formyl? |
| A: InChIKey of Benzoic acid, 2-cyano-3-fluoro-6-formyl is NEQDLKXKEXRTEK-UHFFFAOYSA-N. |
| Q: What is the English name of Benzoic acid, 2-cyano-3-fluoro-6-formyl? |
| A: The English name of Benzoic acid, 2-cyano-3-fluoro-6-formyl is Benzoic acid, 2-cyano-3-fluoro-6-formyl. |
| Q: What is the CAS number of Benzoic acid, 2-cyano-3-fluoro-6-formyl? |
| A: CAS number of Benzoic acid, 2-cyano-3-fluoro-6-formyl is 1807193-70-9. |
| Q: What is the Chinese name of 1807193-70-9? |
| A: Chinese name of 1807193-70-9 is 1807193-70-9. |
| Q: What is the molecular formula of Benzoic acid, 2-cyano-3-fluoro-6-formyl? |
| A: Molecular formula of Benzoic acid, 2-cyano-3-fluoro-6-formyl is C9H4FNO3. |
| Q: What is the SMILES notation of Benzoic acid, 2-cyano-3-fluoro-6-formyl? |
| A: SMILES notation of Benzoic acid, 2-cyano-3-fluoro-6-formyl is N#Cc1c(F)ccc(C=O)c1C(=O)O. |