5'-Bromo-2',3'-difluorophenacyl bromide
Modify Date: 2025-09-09 14:53:45
5'-Bromo-2',3'-difluorophenacyl bromide structure
|
Common Name | 5'-Bromo-2',3'-difluorophenacyl bromide | ||
|---|---|---|---|---|
| CAS Number | 1807197-63-2 | Molecular Weight | 313.92 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H4Br2F2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5'-Bromo-2',3'-difluorophenacyl bromide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H4Br2F2O |
|---|---|
| Molecular Weight | 313.92 |
| InChIKey | HTZVSWDVPDQQOV-UHFFFAOYSA-N |
| SMILES | O=C(CBr)c1cc(Br)cc(F)c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5'-Bromo-2',3'-difluorophenacyl bromide? |
| A: Molecular weight of 5'-Bromo-2',3'-difluorophenacyl bromide is 313.92. |
| Q: What is the Chinese name of 1807197-63-2? |
| A: Chinese name of 1807197-63-2 is 1807197-63-2. |
| Q: What is the SMILES notation of 5'-Bromo-2',3'-difluorophenacyl bromide? |
| A: SMILES notation of 5'-Bromo-2',3'-difluorophenacyl bromide is O=C(CBr)c1cc(Br)cc(F)c1F. |
| Q: What is the CAS number of 5'-Bromo-2',3'-difluorophenacyl bromide? |
| A: CAS number of 5'-Bromo-2',3'-difluorophenacyl bromide is 1807197-63-2. |
| Q: What is the InChIKey of 5'-Bromo-2',3'-difluorophenacyl bromide? |
| A: InChIKey of 5'-Bromo-2',3'-difluorophenacyl bromide is HTZVSWDVPDQQOV-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 5'-Bromo-2',3'-difluorophenacyl bromide? |
| A: Molecular formula of 5'-Bromo-2',3'-difluorophenacyl bromide is C8H4Br2F2O. |
| Q: What is the English name of 5'-Bromo-2',3'-difluorophenacyl bromide? |
| A: The English name of 5'-Bromo-2',3'-difluorophenacyl bromide is 5'-Bromo-2',3'-difluorophenacyl bromide. |