4-Chloro-2,3,5-trifluorobenzoic acid
Modify Date: 2025-09-09 16:45:26
4-Chloro-2,3,5-trifluorobenzoic acid structure
|
Common Name | 4-Chloro-2,3,5-trifluorobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1807223-00-2 | Molecular Weight | 210.54 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H2ClF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Chloro-2,3,5-trifluorobenzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H2ClF3O2 |
|---|---|
| Molecular Weight | 210.54 |
| InChIKey | CZAXNGWYBRJLRB-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(F)c(Cl)c(F)c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-Chloro-2,3,5-trifluorobenzoic acid? |
| A: InChIKey of 4-Chloro-2,3,5-trifluorobenzoic acid is CZAXNGWYBRJLRB-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1807223-00-2? |
| A: Chinese name of 1807223-00-2 is 1807223-00-2. |
| Q: What is the CAS number of 4-Chloro-2,3,5-trifluorobenzoic acid? |
| A: CAS number of 4-Chloro-2,3,5-trifluorobenzoic acid is 1807223-00-2. |
| Q: What is the English name of 4-Chloro-2,3,5-trifluorobenzoic acid? |
| A: The English name of 4-Chloro-2,3,5-trifluorobenzoic acid is 4-Chloro-2,3,5-trifluorobenzoic acid. |
| Q: What is the molecular weight of 4-Chloro-2,3,5-trifluorobenzoic acid? |
| A: Molecular weight of 4-Chloro-2,3,5-trifluorobenzoic acid is 210.54. |
| Q: What is the SMILES notation of 4-Chloro-2,3,5-trifluorobenzoic acid? |
| A: SMILES notation of 4-Chloro-2,3,5-trifluorobenzoic acid is O=C(O)c1cc(F)c(Cl)c(F)c1F. |
| Q: What is the molecular formula of 4-Chloro-2,3,5-trifluorobenzoic acid? |
| A: Molecular formula of 4-Chloro-2,3,5-trifluorobenzoic acid is C7H2ClF3O2. |