3'-Bromo-5'-fluoro-4'-hydroxyphenacyl bromide
Modify Date: 2026-08-14 17:31:17
3'-Bromo-5'-fluoro-4'-hydroxyphenacyl bromide structure
|
Common Name | 3'-Bromo-5'-fluoro-4'-hydroxyphenacyl bromide | ||
|---|---|---|---|---|
| CAS Number | 1807230-13-2 | Molecular Weight | 311.93 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5Br2FO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3'-Bromo-5'-fluoro-4'-hydroxyphenacyl bromide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H5Br2FO2 |
|---|---|
| Molecular Weight | 311.93 |
| InChIKey | ODGZRPSANZKBRB-UHFFFAOYSA-N |
| SMILES | O=C(CBr)c1cc(F)c(O)c(Br)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3'-Bromo-5'-fluoro-4'-hydroxyphenacyl bromide? |
| A: Molecular formula of 3'-Bromo-5'-fluoro-4'-hydroxyphenacyl bromide is C8H5Br2FO2. |
| Q: What is the CAS number of 3'-Bromo-5'-fluoro-4'-hydroxyphenacyl bromide? |
| A: CAS number of 3'-Bromo-5'-fluoro-4'-hydroxyphenacyl bromide is 1807230-13-2. |
| Q: What is the SMILES notation of 3'-Bromo-5'-fluoro-4'-hydroxyphenacyl bromide? |
| A: SMILES notation of 3'-Bromo-5'-fluoro-4'-hydroxyphenacyl bromide is O=C(CBr)c1cc(F)c(O)c(Br)c1. |
| Q: What is the InChIKey of 3'-Bromo-5'-fluoro-4'-hydroxyphenacyl bromide? |
| A: InChIKey of 3'-Bromo-5'-fluoro-4'-hydroxyphenacyl bromide is ODGZRPSANZKBRB-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3'-Bromo-5'-fluoro-4'-hydroxyphenacyl bromide? |
| A: Molecular weight of 3'-Bromo-5'-fluoro-4'-hydroxyphenacyl bromide is 311.93. |
| Q: What is the Chinese name of 1807230-13-2? |
| A: Chinese name of 1807230-13-2 is 1807230-13-2. |
| Q: What is the English name of 3'-Bromo-5'-fluoro-4'-hydroxyphenacyl bromide? |
| A: The English name of 3'-Bromo-5'-fluoro-4'-hydroxyphenacyl bromide is 3'-Bromo-5'-fluoro-4'-hydroxyphenacyl bromide. |