Acetaldehyde, (((1,4-dimethylcarbazol-3-yl)methylene)amino)-, diethyl acetal (8CI) structure
|
Common Name | Acetaldehyde, (((1,4-dimethylcarbazol-3-yl)methylene)amino)-, diethyl acetal (8CI) | ||
|---|---|---|---|---|
| CAS Number | 18073-23-9 | Molecular Weight | 338.44300 | |
| Density | 1.11g/cm3 | Boiling Point | 510.5ºC at 760 mmHg | |
| Molecular Formula | C21H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.6ºC | |
| Name | N-(2,2-diethoxyethyl)-1-(1,4-dimethyl-9H-carbazol-3-yl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 510.5ºC at 760 mmHg |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.44300 |
| Flash Point | 262.6ºC |
| Exact Mass | 338.19900 |
| PSA | 46.61000 |
| LogP | 4.75590 |
| Vapour Pressure | 4.91E-10mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | ALTWHROXLXFDIW-UHFFFAOYSA-N |
| SMILES | CCOC(CN=Cc1cc(C)c2[nH]c3ccccc3c2c1C)OCC |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| CARBAZOLE,3-(2,2-DIETHOXYETHYLIMINOMETHYL)-1,4-DIMETHYL |
| 3-(2,2-Diethoxyethyliminomethyl)-1,4-dimethylcarbazole |
| 3-(2,2-Diethoxy-ethylimino-methyl)-1,4-dimethyl-carbazol |
| 3-(2,4-dimethylcarbazole |