3-(2-Bromo-6-(2-carboxyethyl)phenyl)acrylic acid
Modify Date: 2025-08-25 13:10:23
3-(2-Bromo-6-(2-carboxyethyl)phenyl)acrylic acid structure
|
Common Name | 3-(2-Bromo-6-(2-carboxyethyl)phenyl)acrylic acid | ||
|---|---|---|---|---|
| CAS Number | 1807348-74-8 | Molecular Weight | 299.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2-Bromo-6-(2-carboxyethyl)phenyl)acrylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H11BrO4 |
|---|---|
| Molecular Weight | 299.12 |
| InChIKey | MQEJNQVYZWJTJX-FNORWQNLSA-N |
| SMILES | O=C(O)C=Cc1c(Br)cccc1CCC(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-(2-Bromo-6-(2-carboxyethyl)phenyl)acrylic acid? |
| A: InChIKey of 3-(2-Bromo-6-(2-carboxyethyl)phenyl)acrylic acid is MQEJNQVYZWJTJX-FNORWQNLSA-N. |
| Q: What is the molecular weight of 3-(2-Bromo-6-(2-carboxyethyl)phenyl)acrylic acid? |
| A: Molecular weight of 3-(2-Bromo-6-(2-carboxyethyl)phenyl)acrylic acid is 299.12. |
| Q: What is the English name of 3-(2-Bromo-6-(2-carboxyethyl)phenyl)acrylic acid? |
| A: The English name of 3-(2-Bromo-6-(2-carboxyethyl)phenyl)acrylic acid is 3-(2-Bromo-6-(2-carboxyethyl)phenyl)acrylic acid. |
| Q: What is the SMILES notation of 3-(2-Bromo-6-(2-carboxyethyl)phenyl)acrylic acid? |
| A: SMILES notation of 3-(2-Bromo-6-(2-carboxyethyl)phenyl)acrylic acid is O=C(O)C=Cc1c(Br)cccc1CCC(=O)O. |
| Q: What is the CAS number of 3-(2-Bromo-6-(2-carboxyethyl)phenyl)acrylic acid? |
| A: CAS number of 3-(2-Bromo-6-(2-carboxyethyl)phenyl)acrylic acid is 1807348-74-8. |
| Q: What is the Chinese name of 1807348-74-8? |
| A: Chinese name of 1807348-74-8 is 1807348-74-8. |
| Q: What is the molecular formula of 3-(2-Bromo-6-(2-carboxyethyl)phenyl)acrylic acid? |
| A: Molecular formula of 3-(2-Bromo-6-(2-carboxyethyl)phenyl)acrylic acid is C12H11BrO4. |