2-(3-methylpyrazol-1-yl)butanedioic acid structure
|
Common Name | 2-(3-methylpyrazol-1-yl)butanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 180741-28-0 | Molecular Weight | 198.17600 | |
| Density | 1.45g/cm3 | Boiling Point | 350.9ºC at 760 mmHg | |
| Molecular Formula | C8H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166ºC | |
| Name | 2-(3-methylpyrazol-1-yl)butanedioic acid |
|---|
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 350.9ºC at 760 mmHg |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.17600 |
| Flash Point | 166ºC |
| Exact Mass | 198.06400 |
| PSA | 92.42000 |
| LogP | 0.29190 |
| Vapour Pressure | 1.59E-05mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | XMOYXMGSBMYOFG-UHFFFAOYSA-N |
| SMILES | Cc1ccn(C(CC(=O)O)C(=O)O)n1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |