CID 126969716
Modify Date: 2026-08-05 01:41:32
CID 126969716 structure
|
Common Name | CID 126969716 | ||
|---|---|---|---|---|
| CAS Number | 1807439-75-3 | Molecular Weight | 323.94 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5Br2FO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | CID 126969716 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H5Br2FO2 |
|---|---|
| Molecular Weight | 323.94 |
| InChIKey | KJBCGXISSNREJI-UHFFFAOYSA-N |
| SMILES | O=C(O)C=Cc1c(F)ccc(Br)c1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of CID 126969716? |
| A: InChIKey of CID 126969716 is KJBCGXISSNREJI-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of CID 126969716? |
| A: SMILES notation of CID 126969716 is O=C(O)C=Cc1c(F)ccc(Br)c1Br. |
| Q: What is the Chinese name of 1807439-75-3? |
| A: Chinese name of 1807439-75-3 is 1807439-75-3. |
| Q: What is the English name of CID 126969716? |
| A: The English name of CID 126969716 is CID 126969716. |
| Q: What is the CAS number of CID 126969716? |
| A: CAS number of CID 126969716 is 1807439-75-3. |
| Q: What is the molecular formula of CID 126969716? |
| A: Molecular formula of CID 126969716 is C9H5Br2FO2. |
| Q: What is the molecular weight of CID 126969716? |
| A: Molecular weight of CID 126969716 is 323.94. |