Diphenyl[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphine
Modify Date: 2025-09-09 22:11:06
![Diphenyl[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphine Structure](https://www.chemsrc.com/extcaspic/037/1807533-71-6.png)
Diphenyl[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphine structure
|
Common Name | Diphenyl[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphine | ||
|---|---|---|---|---|
| CAS Number | 1807533-71-6 | Molecular Weight | 388.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H26BO2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Diphenyl[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H26BO2P |
|---|---|
| Molecular Weight | 388.2 |
| InChIKey | ZFAAEXOUUQHEIE-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2ccc(P(c3ccccc3)c3ccccc3)cc2)OC1(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Diphenyl[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphine? |
| A: The English name of Diphenyl[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphine is Diphenyl[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphine. |
| Q: What is the Chinese name of 1807533-71-6? |
| A: Chinese name of 1807533-71-6 is 1807533-71-6. |
| Q: What is the molecular weight of Diphenyl[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphine? |
| A: Molecular weight of Diphenyl[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphine is 388.2. |
| Q: What is the InChIKey of Diphenyl[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphine? |
| A: InChIKey of Diphenyl[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphine is ZFAAEXOUUQHEIE-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Diphenyl[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphine? |
| A: SMILES notation of Diphenyl[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphine is CC1(C)OB(c2ccc(P(c3ccccc3)c3ccccc3)cc2)OC1(C)C. |
| Q: What is the CAS number of Diphenyl[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphine? |
| A: CAS number of Diphenyl[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphine is 1807533-71-6. |
| Q: What is the molecular formula of Diphenyl[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphine? |
| A: Molecular formula of Diphenyl[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphine is C24H26BO2P. |