Tris((trimethylsilylmethyl))phosphine structure
|
Common Name | Tris((trimethylsilylmethyl))phosphine | ||
|---|---|---|---|---|
| CAS Number | 18077-42-4 | Molecular Weight | 292.621 | |
| Density | N/A | Boiling Point | 292.8±20.0 °C at 760 mmHg | |
| Molecular Formula | C12H33PSi3 | Melting Point | 66-70ºC | |
| MSDS | N/A | Flash Point | 130.9±21.8 °C | |
| Name | tris(trimethylsilylmethyl)phosphane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 292.8±20.0 °C at 760 mmHg |
|---|---|
| Melting Point | 66-70ºC |
| Molecular Formula | C12H33PSi3 |
| Molecular Weight | 292.621 |
| Flash Point | 130.9±21.8 °C |
| Exact Mass | 292.162750 |
| PSA | 13.59000 |
| LogP | 5.47 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| InChIKey | KXTJYOAWQBBWAQ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CP(C[Si](C)(C)C)C[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
|
~%
Tris((trimethyl... CAS#:18077-42-4 |
| Literature: Seyferth Journal of the American Chemical Society, 1958 , vol. 80, p. 1336 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| TRIS(TRIMETHYLSILYLMETHYL)PHOSPHINE |
| Phosphine, tris[(trimethylsilyl)methyl]- |
| tris-trimethylsilanylmethyl-phosphine |
| Tris-(trimethylsilylmethyl)-phosphin |
| EINECS 241-986-4 |
| Tris[(trimethylsilyl)methyl]phosphine |
| Tris((trimethylsilylmethyl))phosphine |