2-(3-chloro-1H-1,2,4-triazol-1-yl)-4,6-dimethylpyridine-3-carbonitrile
Modify Date: 2026-07-22 14:10:12
2-(3-chloro-1H-1,2,4-triazol-1-yl)-4,6-dimethylpyridine-3-carbonitrile structure
|
Common Name | 2-(3-chloro-1H-1,2,4-triazol-1-yl)-4,6-dimethylpyridine-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 1807977-49-6 | Molecular Weight | 233.66 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3-chloro-1H-1,2,4-triazol-1-yl)-4,6-dimethylpyridine-3-carbonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H8ClN5 |
|---|---|
| Molecular Weight | 233.66 |
| InChIKey | PBFRWKWWUJIIIU-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C#N)c(-n2cnc(Cl)n2)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-(3-chloro-1H-1,2,4-triazol-1-yl)-4,6-dimethylpyridine-3-carbonitrile? |
| A: InChIKey of 2-(3-chloro-1H-1,2,4-triazol-1-yl)-4,6-dimethylpyridine-3-carbonitrile is PBFRWKWWUJIIIU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-(3-chloro-1H-1,2,4-triazol-1-yl)-4,6-dimethylpyridine-3-carbonitrile? |
| A: SMILES notation of 2-(3-chloro-1H-1,2,4-triazol-1-yl)-4,6-dimethylpyridine-3-carbonitrile is Cc1cc(C)c(C#N)c(-n2cnc(Cl)n2)n1. |
| Q: What is the CAS number of 2-(3-chloro-1H-1,2,4-triazol-1-yl)-4,6-dimethylpyridine-3-carbonitrile? |
| A: CAS number of 2-(3-chloro-1H-1,2,4-triazol-1-yl)-4,6-dimethylpyridine-3-carbonitrile is 1807977-49-6. |
| Q: What is the molecular weight of 2-(3-chloro-1H-1,2,4-triazol-1-yl)-4,6-dimethylpyridine-3-carbonitrile? |
| A: Molecular weight of 2-(3-chloro-1H-1,2,4-triazol-1-yl)-4,6-dimethylpyridine-3-carbonitrile is 233.66. |
| Q: What is the molecular formula of 2-(3-chloro-1H-1,2,4-triazol-1-yl)-4,6-dimethylpyridine-3-carbonitrile? |
| A: Molecular formula of 2-(3-chloro-1H-1,2,4-triazol-1-yl)-4,6-dimethylpyridine-3-carbonitrile is C10H8ClN5. |
| Q: What is the Chinese name of 1807977-49-6? |
| A: Chinese name of 1807977-49-6 is 1807977-49-6. |
| Q: What is the English name of 2-(3-chloro-1H-1,2,4-triazol-1-yl)-4,6-dimethylpyridine-3-carbonitrile? |
| A: The English name of 2-(3-chloro-1H-1,2,4-triazol-1-yl)-4,6-dimethylpyridine-3-carbonitrile is 2-(3-chloro-1H-1,2,4-triazol-1-yl)-4,6-dimethylpyridine-3-carbonitrile. |