5-amino-2-[(2,5-difluorophenyl)carbonyl]-1,2-oxazol-3(2H)-one
Modify Date: 2026-07-05 14:42:04
![5-amino-2-[(2,5-difluorophenyl)carbonyl]-1,2-oxazol-3(2H)-one Structure](https://www.chemsrc.com/extcaspic/333/1807982-64-4.png)
5-amino-2-[(2,5-difluorophenyl)carbonyl]-1,2-oxazol-3(2H)-one structure
|
Common Name | 5-amino-2-[(2,5-difluorophenyl)carbonyl]-1,2-oxazol-3(2H)-one | ||
|---|---|---|---|---|
| CAS Number | 1807982-64-4 | Molecular Weight | 240.16 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H6F2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-amino-2-[(2,5-difluorophenyl)carbonyl]-1,2-oxazol-3(2H)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H6F2N2O3 |
|---|---|
| Molecular Weight | 240.16 |
| InChIKey | GDVMWDKICWGAKO-UHFFFAOYSA-N |
| SMILES | Nc1cc(=O)n(C(=O)c2cc(F)ccc2F)o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-amino-2-[(2,5-difluorophenyl)carbonyl]-1,2-oxazol-3(2H)-one? |
| A: InChIKey of 5-amino-2-[(2,5-difluorophenyl)carbonyl]-1,2-oxazol-3(2H)-one is GDVMWDKICWGAKO-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1807982-64-4? |
| A: Chinese name of 1807982-64-4 is 1807982-64-4. |
| Q: What is the CAS number of 5-amino-2-[(2,5-difluorophenyl)carbonyl]-1,2-oxazol-3(2H)-one? |
| A: CAS number of 5-amino-2-[(2,5-difluorophenyl)carbonyl]-1,2-oxazol-3(2H)-one is 1807982-64-4. |
| Q: What is the SMILES notation of 5-amino-2-[(2,5-difluorophenyl)carbonyl]-1,2-oxazol-3(2H)-one? |
| A: SMILES notation of 5-amino-2-[(2,5-difluorophenyl)carbonyl]-1,2-oxazol-3(2H)-one is Nc1cc(=O)n(C(=O)c2cc(F)ccc2F)o1. |
| Q: What is the English name of 5-amino-2-[(2,5-difluorophenyl)carbonyl]-1,2-oxazol-3(2H)-one? |
| A: The English name of 5-amino-2-[(2,5-difluorophenyl)carbonyl]-1,2-oxazol-3(2H)-one is 5-amino-2-[(2,5-difluorophenyl)carbonyl]-1,2-oxazol-3(2H)-one. |
| Q: What is the molecular formula of 5-amino-2-[(2,5-difluorophenyl)carbonyl]-1,2-oxazol-3(2H)-one? |
| A: Molecular formula of 5-amino-2-[(2,5-difluorophenyl)carbonyl]-1,2-oxazol-3(2H)-one is C10H6F2N2O3. |
| Q: What is the molecular weight of 5-amino-2-[(2,5-difluorophenyl)carbonyl]-1,2-oxazol-3(2H)-one? |
| A: Molecular weight of 5-amino-2-[(2,5-difluorophenyl)carbonyl]-1,2-oxazol-3(2H)-one is 240.16. |