Methyl 6-((((2-cyanoethoxy)(diisopropylamino)phosphanyl)-oxy)methyl) nicotinate
Modify Date: 2026-07-06 12:54:49
Methyl 6-((((2-cyanoethoxy)(diisopropylamino)phosphanyl)-oxy)methyl) nicotinate structure
|
Common Name | Methyl 6-((((2-cyanoethoxy)(diisopropylamino)phosphanyl)-oxy)methyl) nicotinate | ||
|---|---|---|---|---|
| CAS Number | 1808096-82-3 | Molecular Weight | 367.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H26N3O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 6-((((2-cyanoethoxy)(diisopropylamino)phosphanyl)-oxy)methyl) nicotinate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H26N3O4P |
|---|---|
| Molecular Weight | 367.4 |
| InChIKey | BPSKMWNDDVVASZ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(COP(OCCC#N)N(C(C)C)C(C)C)nc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Methyl 6-((((2-cyanoethoxy)(diisopropylamino)phosphanyl)-oxy)methyl) nicotinate? |
| A: Molecular formula of Methyl 6-((((2-cyanoethoxy)(diisopropylamino)phosphanyl)-oxy)methyl) nicotinate is C17H26N3O4P. |
| Q: What is the SMILES notation of Methyl 6-((((2-cyanoethoxy)(diisopropylamino)phosphanyl)-oxy)methyl) nicotinate? |
| A: SMILES notation of Methyl 6-((((2-cyanoethoxy)(diisopropylamino)phosphanyl)-oxy)methyl) nicotinate is COC(=O)c1ccc(COP(OCCC#N)N(C(C)C)C(C)C)nc1. |
| Q: What is the molecular weight of Methyl 6-((((2-cyanoethoxy)(diisopropylamino)phosphanyl)-oxy)methyl) nicotinate? |
| A: Molecular weight of Methyl 6-((((2-cyanoethoxy)(diisopropylamino)phosphanyl)-oxy)methyl) nicotinate is 367.4. |
| Q: What is the Chinese name of 1808096-82-3? |
| A: Chinese name of 1808096-82-3 is 1808096-82-3. |
| Q: What is the CAS number of Methyl 6-((((2-cyanoethoxy)(diisopropylamino)phosphanyl)-oxy)methyl) nicotinate? |
| A: CAS number of Methyl 6-((((2-cyanoethoxy)(diisopropylamino)phosphanyl)-oxy)methyl) nicotinate is 1808096-82-3. |
| Q: What is the InChIKey of Methyl 6-((((2-cyanoethoxy)(diisopropylamino)phosphanyl)-oxy)methyl) nicotinate? |
| A: InChIKey of Methyl 6-((((2-cyanoethoxy)(diisopropylamino)phosphanyl)-oxy)methyl) nicotinate is BPSKMWNDDVVASZ-UHFFFAOYSA-N. |
| Q: What is the English name of Methyl 6-((((2-cyanoethoxy)(diisopropylamino)phosphanyl)-oxy)methyl) nicotinate? |
| A: The English name of Methyl 6-((((2-cyanoethoxy)(diisopropylamino)phosphanyl)-oxy)methyl) nicotinate is Methyl 6-((((2-cyanoethoxy)(diisopropylamino)phosphanyl)-oxy)methyl) nicotinate. |