1,4-Di-tert-butyl 2-methyl 2-allylpiperazine-1,2,4-tricarboxylate
Modify Date: 2026-09-28 01:23:51
1,4-Di-tert-butyl 2-methyl 2-allylpiperazine-1,2,4-tricarboxylate structure
|
Common Name | 1,4-Di-tert-butyl 2-methyl 2-allylpiperazine-1,2,4-tricarboxylate | ||
|---|---|---|---|---|
| CAS Number | 1808248-87-4 | Molecular Weight | 384.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H32N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4-Di-tert-butyl 2-methyl 2-allylpiperazine-1,2,4-tricarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H32N2O6 |
|---|---|
| Molecular Weight | 384.5 |
| InChIKey | NMWMUUHGUTZPOV-UHFFFAOYSA-N |
| SMILES | C=CCC1(C(=O)OC)CN(C(=O)OC(C)(C)C)CCN1C(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1808248-87-4? |
| A: Chinese name of 1808248-87-4 is 1808248-87-4. |
| Q: What is the English name of 1,4-Di-tert-butyl 2-methyl 2-allylpiperazine-1,2,4-tricarboxylate? |
| A: The English name of 1,4-Di-tert-butyl 2-methyl 2-allylpiperazine-1,2,4-tricarboxylate is 1,4-Di-tert-butyl 2-methyl 2-allylpiperazine-1,2,4-tricarboxylate. |
| Q: What is the SMILES notation of 1,4-Di-tert-butyl 2-methyl 2-allylpiperazine-1,2,4-tricarboxylate? |
| A: SMILES notation of 1,4-Di-tert-butyl 2-methyl 2-allylpiperazine-1,2,4-tricarboxylate is C=CCC1(C(=O)OC)CN(C(=O)OC(C)(C)C)CCN1C(=O)OC(C)(C)C. |
| Q: What is the CAS number of 1,4-Di-tert-butyl 2-methyl 2-allylpiperazine-1,2,4-tricarboxylate? |
| A: CAS number of 1,4-Di-tert-butyl 2-methyl 2-allylpiperazine-1,2,4-tricarboxylate is 1808248-87-4. |
| Q: What is the molecular weight of 1,4-Di-tert-butyl 2-methyl 2-allylpiperazine-1,2,4-tricarboxylate? |
| A: Molecular weight of 1,4-Di-tert-butyl 2-methyl 2-allylpiperazine-1,2,4-tricarboxylate is 384.5. |
| Q: What is the molecular formula of 1,4-Di-tert-butyl 2-methyl 2-allylpiperazine-1,2,4-tricarboxylate? |
| A: Molecular formula of 1,4-Di-tert-butyl 2-methyl 2-allylpiperazine-1,2,4-tricarboxylate is C19H32N2O6. |
| Q: What is the InChIKey of 1,4-Di-tert-butyl 2-methyl 2-allylpiperazine-1,2,4-tricarboxylate? |
| A: InChIKey of 1,4-Di-tert-butyl 2-methyl 2-allylpiperazine-1,2,4-tricarboxylate is NMWMUUHGUTZPOV-UHFFFAOYSA-N. |