Di-tert-butyl 2-allyl-2-formylpiperazine-1,4-dicarboxylate
Modify Date: 2025-08-28 22:03:43
Di-tert-butyl 2-allyl-2-formylpiperazine-1,4-dicarboxylate structure
|
Common Name | Di-tert-butyl 2-allyl-2-formylpiperazine-1,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 1808248-89-6 | Molecular Weight | 354.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H30N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Di-tert-butyl 2-allyl-2-formylpiperazine-1,4-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H30N2O5 |
|---|---|
| Molecular Weight | 354.4 |
| InChIKey | OXFNFCDCJAMWJA-UHFFFAOYSA-N |
| SMILES | C=CCC1(C=O)CN(C(=O)OC(C)(C)C)CCN1C(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Di-tert-butyl 2-allyl-2-formylpiperazine-1,4-dicarboxylate? |
| A: Molecular formula of Di-tert-butyl 2-allyl-2-formylpiperazine-1,4-dicarboxylate is C18H30N2O5. |
| Q: What is the CAS number of Di-tert-butyl 2-allyl-2-formylpiperazine-1,4-dicarboxylate? |
| A: CAS number of Di-tert-butyl 2-allyl-2-formylpiperazine-1,4-dicarboxylate is 1808248-89-6. |
| Q: What is the InChIKey of Di-tert-butyl 2-allyl-2-formylpiperazine-1,4-dicarboxylate? |
| A: InChIKey of Di-tert-butyl 2-allyl-2-formylpiperazine-1,4-dicarboxylate is OXFNFCDCJAMWJA-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1808248-89-6? |
| A: Chinese name of 1808248-89-6 is 1808248-89-6. |
| Q: What is the molecular weight of Di-tert-butyl 2-allyl-2-formylpiperazine-1,4-dicarboxylate? |
| A: Molecular weight of Di-tert-butyl 2-allyl-2-formylpiperazine-1,4-dicarboxylate is 354.4. |
| Q: What is the English name of Di-tert-butyl 2-allyl-2-formylpiperazine-1,4-dicarboxylate? |
| A: The English name of Di-tert-butyl 2-allyl-2-formylpiperazine-1,4-dicarboxylate is Di-tert-butyl 2-allyl-2-formylpiperazine-1,4-dicarboxylate. |
| Q: What is the SMILES notation of Di-tert-butyl 2-allyl-2-formylpiperazine-1,4-dicarboxylate? |
| A: SMILES notation of Di-tert-butyl 2-allyl-2-formylpiperazine-1,4-dicarboxylate is C=CCC1(C=O)CN(C(=O)OC(C)(C)C)CCN1C(=O)OC(C)(C)C. |