3-(2-Bromoethynyl)-1-azetidinecarboxylic acid,1,1-dimethylethyl ester
Modify Date: 2026-08-21 11:27:16
3-(2-Bromoethynyl)-1-azetidinecarboxylic acid,1,1-dimethylethyl ester structure
|
Common Name | 3-(2-Bromoethynyl)-1-azetidinecarboxylic acid,1,1-dimethylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1808271-69-3 | Molecular Weight | 260.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2-Bromoethynyl)-1-azetidinecarboxylic acid,1,1-dimethylethyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H14BrNO2 |
|---|---|
| Molecular Weight | 260.13 |
| InChIKey | GZMBUMNQWDAKOO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C#CBr)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-(2-Bromoethynyl)-1-azetidinecarboxylic acid,1,1-dimethylethyl ester? |
| A: CAS number of 3-(2-Bromoethynyl)-1-azetidinecarboxylic acid,1,1-dimethylethyl ester is 1808271-69-3. |
| Q: What is the English name of 3-(2-Bromoethynyl)-1-azetidinecarboxylic acid,1,1-dimethylethyl ester? |
| A: The English name of 3-(2-Bromoethynyl)-1-azetidinecarboxylic acid,1,1-dimethylethyl ester is 3-(2-Bromoethynyl)-1-azetidinecarboxylic acid,1,1-dimethylethyl ester. |
| Q: What is the molecular weight of 3-(2-Bromoethynyl)-1-azetidinecarboxylic acid,1,1-dimethylethyl ester? |
| A: Molecular weight of 3-(2-Bromoethynyl)-1-azetidinecarboxylic acid,1,1-dimethylethyl ester is 260.13. |
| Q: What is the Chinese name of 1808271-69-3? |
| A: Chinese name of 1808271-69-3 is 1808271-69-3. |
| Q: What is the molecular formula of 3-(2-Bromoethynyl)-1-azetidinecarboxylic acid,1,1-dimethylethyl ester? |
| A: Molecular formula of 3-(2-Bromoethynyl)-1-azetidinecarboxylic acid,1,1-dimethylethyl ester is C10H14BrNO2. |
| Q: What is the InChIKey of 3-(2-Bromoethynyl)-1-azetidinecarboxylic acid,1,1-dimethylethyl ester? |
| A: InChIKey of 3-(2-Bromoethynyl)-1-azetidinecarboxylic acid,1,1-dimethylethyl ester is GZMBUMNQWDAKOO-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-(2-Bromoethynyl)-1-azetidinecarboxylic acid,1,1-dimethylethyl ester? |
| A: SMILES notation of 3-(2-Bromoethynyl)-1-azetidinecarboxylic acid,1,1-dimethylethyl ester is CC(C)(C)OC(=O)N1CC(C#CBr)C1. |