(2S,5S)-5-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid hydrochloride
Modify Date: 2026-08-13 18:02:56
(2S,5S)-5-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid hydrochloride structure
|
Common Name | (2S,5S)-5-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1808331-65-8 | Molecular Weight | 257.71 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S,5S)-5-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16ClNO3 |
|---|---|
| Molecular Weight | 257.71 |
| InChIKey | WZGDHJDYFOKJNA-ACMTZBLWSA-N |
| SMILES | COc1ccc(C2CCC(C(=O)O)N2)cc1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1808331-65-8? |
| A: Chinese name of 1808331-65-8 is 1808331-65-8. |
| Q: What is the molecular formula of (2S,5S)-5-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid hydrochloride? |
| A: Molecular formula of (2S,5S)-5-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid hydrochloride is C12H16ClNO3. |
| Q: What is the SMILES notation of (2S,5S)-5-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid hydrochloride? |
| A: SMILES notation of (2S,5S)-5-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid hydrochloride is COc1ccc(C2CCC(C(=O)O)N2)cc1.Cl. |
| Q: What is the English name of (2S,5S)-5-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid hydrochloride? |
| A: The English name of (2S,5S)-5-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid hydrochloride is (2S,5S)-5-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid hydrochloride. |
| Q: What is the molecular weight of (2S,5S)-5-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid hydrochloride? |
| A: Molecular weight of (2S,5S)-5-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid hydrochloride is 257.71. |
| Q: What is the CAS number of (2S,5S)-5-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid hydrochloride? |
| A: CAS number of (2S,5S)-5-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid hydrochloride is 1808331-65-8. |
| Q: What is the InChIKey of (2S,5S)-5-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid hydrochloride? |
| A: InChIKey of (2S,5S)-5-(4-methoxyphenyl)pyrrolidine-2-carboxylic acid hydrochloride is WZGDHJDYFOKJNA-ACMTZBLWSA-N. |