N-[(2,5-dibromophenyl)methyl]but-2-ynamide
Modify Date: 2026-09-28 09:55:00
![N-[(2,5-dibromophenyl)methyl]but-2-ynamide Structure](https://www.chemsrc.com/extcaspic/175/1808835-64-4.png)
N-[(2,5-dibromophenyl)methyl]but-2-ynamide structure
|
Common Name | N-[(2,5-dibromophenyl)methyl]but-2-ynamide | ||
|---|---|---|---|---|
| CAS Number | 1808835-64-4 | Molecular Weight | 331.00 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9Br2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[(2,5-dibromophenyl)methyl]but-2-ynamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H9Br2NO |
|---|---|
| Molecular Weight | 331.00 |
| InChIKey | XEOBODFTYCCIAV-UHFFFAOYSA-N |
| SMILES | CC#CC(=O)NCc1cc(Br)ccc1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-[(2,5-dibromophenyl)methyl]but-2-ynamide? |
| A: SMILES notation of N-[(2,5-dibromophenyl)methyl]but-2-ynamide is CC#CC(=O)NCc1cc(Br)ccc1Br. |
| Q: What is the CAS number of N-[(2,5-dibromophenyl)methyl]but-2-ynamide? |
| A: CAS number of N-[(2,5-dibromophenyl)methyl]but-2-ynamide is 1808835-64-4. |
| Q: What is the Chinese name of 1808835-64-4? |
| A: Chinese name of 1808835-64-4 is 1808835-64-4. |
| Q: What is the InChIKey of N-[(2,5-dibromophenyl)methyl]but-2-ynamide? |
| A: InChIKey of N-[(2,5-dibromophenyl)methyl]but-2-ynamide is XEOBODFTYCCIAV-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-[(2,5-dibromophenyl)methyl]but-2-ynamide? |
| A: Molecular formula of N-[(2,5-dibromophenyl)methyl]but-2-ynamide is C11H9Br2NO. |
| Q: What is the English name of N-[(2,5-dibromophenyl)methyl]but-2-ynamide? |
| A: The English name of N-[(2,5-dibromophenyl)methyl]but-2-ynamide is N-[(2,5-dibromophenyl)methyl]but-2-ynamide. |
| Q: What is the molecular weight of N-[(2,5-dibromophenyl)methyl]but-2-ynamide? |
| A: Molecular weight of N-[(2,5-dibromophenyl)methyl]but-2-ynamide is 331.00. |