ethyl 1-(2-amino-4-chlorophenyl)sulfonylpyrrole-2-carboxylate
Modify Date: 2025-08-24 00:22:42
ethyl 1-(2-amino-4-chlorophenyl)sulfonylpyrrole-2-carboxylate structure
|
Common Name | ethyl 1-(2-amino-4-chlorophenyl)sulfonylpyrrole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 180905-83-3 | Molecular Weight | 328.77100 | |
| Density | 1.46g/cm3 | Boiling Point | 521.1ºC at 760 mmHg | |
| Molecular Formula | C13H13ClN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.9ºC | |
| Name | ethyl 1-(2-amino-4-chlorophenyl)sulfonylpyrrole-2-carboxylate |
|---|
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 521.1ºC at 760 mmHg |
| Molecular Formula | C13H13ClN2O4S |
| Molecular Weight | 328.77100 |
| Flash Point | 268.9ºC |
| Exact Mass | 328.02800 |
| PSA | 99.77000 |
| LogP | 3.79940 |
| Vapour Pressure | 5.88E-11mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | GPLGLDBNRNFNTD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cccn1S(=O)(=O)c1ccc(Cl)cc1N |
|
~82%
ethyl 1-(2-amin... CAS#:180905-83-3 |
| Literature: Artico; Silvestri; Pagnozzi; Stefancich; Massa; Loi; Putzolu; Corrias; Spiga; La Colla Bioorganic and Medicinal Chemistry, 1996 , vol. 4, # 6 p. 837 - 850 |
