ethyl 1-(2-amino-5-chlorophenyl)sulfonylpyrrole-2-carboxylate structure
|
Common Name | ethyl 1-(2-amino-5-chlorophenyl)sulfonylpyrrole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 180905-84-4 | Molecular Weight | 328.77100 | |
| Density | 1.46g/cm3 | Boiling Point | 529.8ºC at 760 mmHg | |
| Molecular Formula | C13H13ClN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.2ºC | |
| Name | ethyl 1-(2-amino-5-chlorophenyl)sulfonylpyrrole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 529.8ºC at 760 mmHg |
| Molecular Formula | C13H13ClN2O4S |
| Molecular Weight | 328.77100 |
| Flash Point | 274.2ºC |
| Exact Mass | 328.02800 |
| PSA | 99.77000 |
| LogP | 3.79940 |
| Vapour Pressure | 2.61E-11mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | SMNXJEBYPOVRHP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cccn1S(=O)(=O)c1cc(Cl)ccc1N |
|
~%
ethyl 1-(2-amin... CAS#:180905-84-4 |
| Literature: Silvestri, Romano; Pifferi, Augusto; De Martino, Gabriella; Massa, Silvio; Saturnino, Carmela; Artico, Marino Heterocycles, 2000 , vol. 53, # 10 p. 2163 - 2174 |
|
~%
ethyl 1-(2-amin... CAS#:180905-84-4 |
| Literature: Artico; Silvestri; Pagnozzi; Stefancich; Massa; Loi; Putzolu; Corrias; Spiga; La Colla Bioorganic and Medicinal Chemistry, 1996 , vol. 4, # 6 p. 837 - 850 |
| 2-amino-5-chlorophenyl 2-ethoxycarbonyl-1H-pyrrol-1-yl sulfone |