ethyl 1-(2-fluorophenyl)sulfonylpyrrole-2-carboxylate structure
|
Common Name | ethyl 1-(2-fluorophenyl)sulfonylpyrrole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 180905-85-5 | Molecular Weight | 297.30200 | |
| Density | 1.34g/cm3 | Boiling Point | 444.1ºC at 760mmHg | |
| Molecular Formula | C13H12FNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.4ºC | |
| Name | ethyl 1-(2-fluorophenyl)sulfonylpyrrole-2-carboxylate |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 444.1ºC at 760mmHg |
| Molecular Formula | C13H12FNO4S |
| Molecular Weight | 297.30200 |
| Flash Point | 222.4ºC |
| Exact Mass | 297.04700 |
| PSA | 73.75000 |
| LogP | 3.12170 |
| Vapour Pressure | 4.38E-08mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | YMKJWDSOMTUNAD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cccn1S(=O)(=O)c1ccccc1F |
|
Name: Selectivity index expressed as the ratio of CC50/ EC50
Source: ChEMBL
Target: MT4
External Id: CHEMBL840536
|
|
Name: Effective concentration against HIV-1 induced cytopathogenicity in MT-4 cells
Source: ChEMBL
Target: MT4
External Id: CHEMBL712401
|
|
Name: Concentration required to reduce the viability of mock-infected MT-4 cells by 50%
Source: ChEMBL
Target: MT4
External Id: CHEMBL709816
|