3-methyl-2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)pentanoic acid structure
|
Common Name | 3-methyl-2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 180923-81-3 | Molecular Weight | 247.29000 | |
| Density | 1.22g/cm3 | Boiling Point | 444.251ºC at 760 mmHg | |
| Molecular Formula | C14H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.475ºC | |
| Name | 3-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 444.251ºC at 760 mmHg |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29000 |
| Flash Point | 222.475ºC |
| Exact Mass | 247.12100 |
| PSA | 57.61000 |
| LogP | 2.07960 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | SDNDNHOVHJTJPB-UHFFFAOYSA-N |
| SMILES | CCC(C)C(C(=O)O)N1Cc2ccccc2C1=O |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-methyl-2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)pentanoic acid |