Rel-(3R,4R)-1-(tert-butoxycarbonyl)-4-isobutylpyrrolidine-3-carboxylic acid
Modify Date: 2025-09-09 14:57:43
Rel-(3R,4R)-1-(tert-butoxycarbonyl)-4-isobutylpyrrolidine-3-carboxylic acid structure
|
Common Name | Rel-(3R,4R)-1-(tert-butoxycarbonyl)-4-isobutylpyrrolidine-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1809341-59-0 | Molecular Weight | 271.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Rel-(3R,4R)-1-(tert-butoxycarbonyl)-4-isobutylpyrrolidine-3-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H25NO4 |
|---|---|
| Molecular Weight | 271.35 |
| InChIKey | NJFRXVHRFWVXAR-QWRGUYRKSA-N |
| SMILES | CC(C)CC1CN(C(=O)OC(C)(C)C)CC1C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1809341-59-0? |
| A: Chinese name of 1809341-59-0 is 1809341-59-0. |
| Q: What is the CAS number of Rel-(3R,4R)-1-(tert-butoxycarbonyl)-4-isobutylpyrrolidine-3-carboxylic acid? |
| A: CAS number of Rel-(3R,4R)-1-(tert-butoxycarbonyl)-4-isobutylpyrrolidine-3-carboxylic acid is 1809341-59-0. |
| Q: What is the InChIKey of Rel-(3R,4R)-1-(tert-butoxycarbonyl)-4-isobutylpyrrolidine-3-carboxylic acid? |
| A: InChIKey of Rel-(3R,4R)-1-(tert-butoxycarbonyl)-4-isobutylpyrrolidine-3-carboxylic acid is NJFRXVHRFWVXAR-QWRGUYRKSA-N. |
| Q: What is the English name of Rel-(3R,4R)-1-(tert-butoxycarbonyl)-4-isobutylpyrrolidine-3-carboxylic acid? |
| A: The English name of Rel-(3R,4R)-1-(tert-butoxycarbonyl)-4-isobutylpyrrolidine-3-carboxylic acid is Rel-(3R,4R)-1-(tert-butoxycarbonyl)-4-isobutylpyrrolidine-3-carboxylic acid. |
| Q: What is the molecular weight of Rel-(3R,4R)-1-(tert-butoxycarbonyl)-4-isobutylpyrrolidine-3-carboxylic acid? |
| A: Molecular weight of Rel-(3R,4R)-1-(tert-butoxycarbonyl)-4-isobutylpyrrolidine-3-carboxylic acid is 271.35. |
| Q: What is the molecular formula of Rel-(3R,4R)-1-(tert-butoxycarbonyl)-4-isobutylpyrrolidine-3-carboxylic acid? |
| A: Molecular formula of Rel-(3R,4R)-1-(tert-butoxycarbonyl)-4-isobutylpyrrolidine-3-carboxylic acid is C14H25NO4. |
| Q: What is the SMILES notation of Rel-(3R,4R)-1-(tert-butoxycarbonyl)-4-isobutylpyrrolidine-3-carboxylic acid? |
| A: SMILES notation of Rel-(3R,4R)-1-(tert-butoxycarbonyl)-4-isobutylpyrrolidine-3-carboxylic acid is CC(C)CC1CN(C(=O)OC(C)(C)C)CC1C(=O)O. |