3,4-dichloro-N-(2-hydroxyphenyl)benzamide structure
|
Common Name | 3,4-dichloro-N-(2-hydroxyphenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 18094-90-1 | Molecular Weight | 282.12200 | |
| Density | 1.479g/cm3 | Boiling Point | 359.9ºC at 760 mmHg | |
| Molecular Formula | C13H9Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.4ºC | |
| Name | 3,4-dichloro-N-(2-hydroxyphenyl)benzamide |
|---|
| Density | 1.479g/cm3 |
|---|---|
| Boiling Point | 359.9ºC at 760 mmHg |
| Molecular Formula | C13H9Cl2NO2 |
| Molecular Weight | 282.12200 |
| Flash Point | 171.4ºC |
| Exact Mass | 281.00100 |
| PSA | 49.33000 |
| LogP | 4.02430 |
| Vapour Pressure | 1.11E-05mmHg at 25°C |
| Index of Refraction | 1.685 |
| InChIKey | KDKKARRCQSQIHZ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1O)c1ccc(Cl)c(Cl)c1 |
|
~%
3,4-dichloro-N-... CAS#:18094-90-1 |
| Literature: Drain; Daly; Davy; Horlington; Howes; Scruton; Selway The Journal of pharmacy and pharmacology, 1970 , vol. 22, # 9 p. 684 - 693 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |