Boc-4-amino-3-methoxybenzoic acid
Boc-4-amino-3-methoxybenzoic acid structure
|
Common Name | Boc-4-amino-3-methoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 180976-98-1 | Molecular Weight | 267.27800 | |
| Density | 1.243±0.06 g/cm3(Predicted) | Boiling Point | 371.3±32.0 °C(Predicted) | |
| Molecular Formula | C13H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.243±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 371.3±32.0 °C(Predicted) |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.27800 |
| Exact Mass | 267.11100 |
| PSA | 84.86000 |
| LogP | 2.81340 |
| InChIKey | KVXONAJLCIBQKV-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)O)ccc1NC(=O)OC(C)(C)C |
| HS Code | 2924299090 |
|---|
|
~%
Boc-4-amino-3-m... CAS#:180976-98-1 |
| Literature: Tetrahedron Letters, , vol. 48, # 20 p. 3543 - 3547 |
|
~92%
Boc-4-amino-3-m... CAS#:180976-98-1 |
| Literature: Qian, Yimin; Marugan, Juan Jose; Fossum, Renae D.; Vogt, Andreas; Sebti, Said M.; Hamilton, Andrew D. Bioorganic and Medicinal Chemistry, 1999 , vol. 7, # 12 p. 3011 - 3024 |
|
~%
Boc-4-amino-3-m... CAS#:180976-98-1 |
| Literature: Tetrahedron Letters, , vol. 48, # 20 p. 3543 - 3547 |
|
~%
Boc-4-amino-3-m... CAS#:180976-98-1 |
| Literature: Tetrahedron Letters, , vol. 48, # 20 p. 3543 - 3547 |
|
~%
Boc-4-amino-3-m... CAS#:180976-98-1 |
| Literature: Tetrahedron Letters, , vol. 48, # 20 p. 3543 - 3547 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-((tert-Butoxycarbonyl)amino)-3-methoxybenzoic acid |
| N-Boc-4-amino-3-methoxybenzoic acid |
| Benzoic acid,4-[[(1,1-dimethylethoxy)carbonyl]amino]-3-methoxy |