Phenol,5-[[(2,2-diethoxyethyl)amino]methyl]-2-methoxy
![Phenol,5-[[(2,2-diethoxyethyl)amino]methyl]-2-methoxy Structure](https://image.chemsrc.com/caspic/015/1810-57-7.png)
Phenol,5-[[(2,2-diethoxyethyl)amino]methyl]-2-methoxy structure
|
Common Name | Phenol,5-[[(2,2-diethoxyethyl)amino]methyl]-2-methoxy | ||
|---|---|---|---|---|
| CAS Number | 1810-57-7 | Molecular Weight | 269.33700 | |
| Density | 1.081g/cm3 | Boiling Point | 376.4ºC at 760mmHg | |
| Molecular Formula | C14H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-[(2,2-diethoxyethylamino)methyl]-2-methoxyphenol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.081g/cm3 |
|---|---|
| Boiling Point | 376.4ºC at 760mmHg |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.33700 |
| Flash Point | 181.4ºC |
| Exact Mass | 269.16300 |
| PSA | 59.95000 |
| LogP | 2.28040 |
| Vapour Pressure | 3.36E-06mmHg at 25°C |
| Index of Refraction | 1.51 |
| InChIKey | QLEXOQDDYBZCBI-UHFFFAOYSA-N |
| SMILES | CCOC(CNCc1ccc(OC)c(O)c1)OCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Phenol,5-[[(2,2... CAS#:1810-57-7 |
| Literature: Christinaki, Helene; Bister-Miel, Francoise; Hammoumi, Abderahmane; Bury, Michele; Guignard, Jean-Louis; Viel, Claude Phytochemistry (Elsevier), 1987 , vol. 26, # 11 p. 2991 - 2994 |
|
~%
Phenol,5-[[(2,2... CAS#:1810-57-7 |
| Literature: Christinaki, Helene; Bister-Miel, Francoise; Hammoumi, Abderahmane; Bury, Michele; Guignard, Jean-Louis; Viel, Claude Phytochemistry (Elsevier), 1987 , vol. 26, # 11 p. 2991 - 2994 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Hydroxy-4-methoxy-benzylamino-acetaldehyd-diaethylacetal |
| 4-methoxy-3-hydroxy benzylamino acetaldehyde diethylacetal |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 5-[(2,2-diethoxyethylamino)methyl]-2-methoxyphenol? |
| A: Boiling point of 5-[(2,2-diethoxyethylamino)methyl]-2-methoxyphenol is 376.4ºC at 760mmHg. |
| Q: What are the upstream materials of 5-[(2,2-diethoxyethylamino)methyl]-2-methoxyphenol? |
| A: Related upstream materials(CAS) of 5-[(2,2-diethoxyethylamino)methyl]-2-methoxyphenol: 621-59-0;645-36-3. |
| Q: What is the English name of 5-[(2,2-diethoxyethylamino)methyl]-2-methoxyphenol? |
| A: The English name of 5-[(2,2-diethoxyethylamino)methyl]-2-methoxyphenol is 5-[(2,2-diethoxyethylamino)methyl]-2-methoxyphenol. |
| Q: What is the Chinese name of 1810-57-7? |
| A: Chinese name of 1810-57-7 is 1810-57-7. |
| Q: What is the SMILES notation of 5-[(2,2-diethoxyethylamino)methyl]-2-methoxyphenol? |
| A: SMILES notation of 5-[(2,2-diethoxyethylamino)methyl]-2-methoxyphenol is CCOC(CNCc1ccc(OC)c(O)c1)OCC. |
| Q: What is the polar surface area (PSA) of 5-[(2,2-diethoxyethylamino)methyl]-2-methoxyphenol? |
| A: Polar surface area (PSA) of 5-[(2,2-diethoxyethylamino)methyl]-2-methoxyphenol is 59.95000. |
| Q: What is the molecular weight of 5-[(2,2-diethoxyethylamino)methyl]-2-methoxyphenol? |
| A: Molecular weight of 5-[(2,2-diethoxyethylamino)methyl]-2-methoxyphenol is 269.33700. |
| Q: What is the molecular formula of 5-[(2,2-diethoxyethylamino)methyl]-2-methoxyphenol? |
| A: Molecular formula of 5-[(2,2-diethoxyethylamino)methyl]-2-methoxyphenol is C14H23NO4. |
| Q: What is the InChIKey of 5-[(2,2-diethoxyethylamino)methyl]-2-methoxyphenol? |
| A: InChIKey of 5-[(2,2-diethoxyethylamino)methyl]-2-methoxyphenol is QLEXOQDDYBZCBI-UHFFFAOYSA-N. |
| Q: What is the LogP of 5-[(2,2-diethoxyethylamino)methyl]-2-methoxyphenol? |
| A: LogP of 5-[(2,2-diethoxyethylamino)methyl]-2-methoxyphenol is 2.28040. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |