Acetylene-PEG4-carboxytetramethylrhodamine 110 conjugate
Modify Date: 2025-09-09 17:04:28
Acetylene-PEG4-carboxytetramethylrhodamine 110 conjugate structure
|
Common Name | Acetylene-PEG4-carboxytetramethylrhodamine 110 conjugate | ||
|---|---|---|---|---|
| CAS Number | 1810073-03-0 | Molecular Weight | 643.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H41N3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Acetylene-PEG4-carboxytetramethylrhodamine 110 conjugate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C36H41N3O8 |
|---|---|
| Molecular Weight | 643.7 |
| InChIKey | KSHPVCLPJYHKKW-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCNC(=O)c1ccc(C(=O)[O-])c(-c2c3ccc(=[N+](C)C)cc-3oc3cc(N(C)C)ccc23)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Acetylene-PEG4-carboxytetramethylrhodamine 110 conjugate? |
| A: CAS number of Acetylene-PEG4-carboxytetramethylrhodamine 110 conjugate is 1810073-03-0. |
| Q: What is the SMILES notation of Acetylene-PEG4-carboxytetramethylrhodamine 110 conjugate? |
| A: SMILES notation of Acetylene-PEG4-carboxytetramethylrhodamine 110 conjugate is C#CCOCCOCCOCCOCCNC(=O)c1ccc(C(=O)[O-])c(-c2c3ccc(=[N+](C)C)cc-3oc3cc(N(C)C)ccc23)c1. |
| Q: What is the InChIKey of Acetylene-PEG4-carboxytetramethylrhodamine 110 conjugate? |
| A: InChIKey of Acetylene-PEG4-carboxytetramethylrhodamine 110 conjugate is KSHPVCLPJYHKKW-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Acetylene-PEG4-carboxytetramethylrhodamine 110 conjugate? |
| A: Molecular weight of Acetylene-PEG4-carboxytetramethylrhodamine 110 conjugate is 643.7. |
| Q: What is the English name of Acetylene-PEG4-carboxytetramethylrhodamine 110 conjugate? |
| A: The English name of Acetylene-PEG4-carboxytetramethylrhodamine 110 conjugate is Acetylene-PEG4-carboxytetramethylrhodamine 110 conjugate. |
| Q: What is the molecular formula of Acetylene-PEG4-carboxytetramethylrhodamine 110 conjugate? |
| A: Molecular formula of Acetylene-PEG4-carboxytetramethylrhodamine 110 conjugate is C36H41N3O8. |
| Q: What is the Chinese name of 1810073-03-0? |
| A: Chinese name of 1810073-03-0 is 1810073-03-0. |