Methyl 4-amino-2-morpholinobenzoate
Modify Date: 2026-08-31 13:24:47
Methyl 4-amino-2-morpholinobenzoate structure
|
Common Name | Methyl 4-amino-2-morpholinobenzoate | ||
|---|---|---|---|---|
| CAS Number | 1810774-13-0 | Molecular Weight | 236.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 4-amino-2-morpholinobenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16N2O3 |
|---|---|
| Molecular Weight | 236.27 |
| InChIKey | PLUWSZXWMAPHQL-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(N)cc1N1CCOCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Methyl 4-amino-2-morpholinobenzoate? |
| A: Molecular weight of Methyl 4-amino-2-morpholinobenzoate is 236.27. |
| Q: What is the English name of Methyl 4-amino-2-morpholinobenzoate? |
| A: The English name of Methyl 4-amino-2-morpholinobenzoate is Methyl 4-amino-2-morpholinobenzoate. |
| Q: What is the CAS number of Methyl 4-amino-2-morpholinobenzoate? |
| A: CAS number of Methyl 4-amino-2-morpholinobenzoate is 1810774-13-0. |
| Q: What is the SMILES notation of Methyl 4-amino-2-morpholinobenzoate? |
| A: SMILES notation of Methyl 4-amino-2-morpholinobenzoate is COC(=O)c1ccc(N)cc1N1CCOCC1. |
| Q: What is the InChIKey of Methyl 4-amino-2-morpholinobenzoate? |
| A: InChIKey of Methyl 4-amino-2-morpholinobenzoate is PLUWSZXWMAPHQL-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Methyl 4-amino-2-morpholinobenzoate? |
| A: Molecular formula of Methyl 4-amino-2-morpholinobenzoate is C12H16N2O3. |
| Q: What is the Chinese name of 1810774-13-0? |
| A: Chinese name of 1810774-13-0 is 1810774-13-0. |