N-[3-(Diethylamino)propyl]-2',6'-dimethyl-2-phenylacetanilide structure
|
Common Name | N-[3-(Diethylamino)propyl]-2',6'-dimethyl-2-phenylacetanilide | ||
|---|---|---|---|---|
| CAS Number | 18109-55-2 | Molecular Weight | 352.51300 | |
| Density | 1.034g/cm3 | Boiling Point | 490.7ºC at 760 mmHg | |
| Molecular Formula | C23H32N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.3ºC | |
| Name | N-[3-(diethylamino)propyl]-N-(2,6-dimethylphenyl)-2-phenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.034g/cm3 |
|---|---|
| Boiling Point | 490.7ºC at 760 mmHg |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.51300 |
| Flash Point | 192.3ºC |
| Exact Mass | 352.25100 |
| PSA | 23.55000 |
| LogP | 4.61100 |
| Vapour Pressure | 8.93E-10mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | STOJUOWCDNPDIQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCN(C(=O)Cc1ccccc1)c1c(C)cccc1C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| sa 105 |