[6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]methanamine
Modify Date: 2025-09-07 23:58:00
![[6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]methanamine Structure](https://www.chemsrc.com/extcaspic/042/1812191-75-5.png)
[6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]methanamine structure
|
Common Name | [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]methanamine | ||
|---|---|---|---|---|
| CAS Number | 1812191-75-5 | Molecular Weight | 231.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]methanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12F3NO |
|---|---|
| Molecular Weight | 231.21 |
| InChIKey | DZHDVKQLSNZCHW-UHFFFAOYSA-N |
| SMILES | NCC1CCOc2ccc(C(F)(F)F)cc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]methanamine? |
| A: Molecular formula of [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]methanamine is C11H12F3NO. |
| Q: What is the InChIKey of [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]methanamine? |
| A: InChIKey of [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]methanamine is DZHDVKQLSNZCHW-UHFFFAOYSA-N. |
| Q: What is the English name of [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]methanamine? |
| A: The English name of [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]methanamine is [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]methanamine. |
| Q: What is the molecular weight of [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]methanamine? |
| A: Molecular weight of [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]methanamine is 231.21. |
| Q: What is the Chinese name of 1812191-75-5? |
| A: Chinese name of 1812191-75-5 is 1812191-75-5. |
| Q: What is the CAS number of [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]methanamine? |
| A: CAS number of [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]methanamine is 1812191-75-5. |
| Q: What is the SMILES notation of [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]methanamine? |
| A: SMILES notation of [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]methanamine is NCC1CCOc2ccc(C(F)(F)F)cc21. |