(S)-Methyl 3-aMino-2-((tert-butoxycarbonyl)aMino)propanoate hydrochloride structure
|
Common Name | (S)-Methyl 3-aMino-2-((tert-butoxycarbonyl)aMino)propanoate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 181228-33-1 | Molecular Weight | 254.71100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H19ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (S)-Methyl 3-aMino-2-((tert-butoxycarbonyl)aMino)propanoate hydrochloride(S)-Methyl 3-amino-2-((tert-butoxycarbonyl)amino)propanoate hydrochloride is an alanine derivative[1]. |
| Name | methyl (2S)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-Methyl 3-amino-2-((tert-butoxycarbonyl)amino)propanoate hydrochloride is an alanine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Molecular Formula | C9H19ClN2O4 |
|---|---|
| Molecular Weight | 254.71100 |
| Exact Mass | 254.10300 |
| PSA | 94.14000 |
| LogP | 1.71810 |
| InChIKey | IKRXWXBVGWAKNK-RGMNGODLSA-N |
| SMILES | COC(=O)C(CN)NC(=O)OC(C)(C)C.Cl |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Boc-L-Dap-OMe*HCl |
| (2S)-3-Amino-2-[[(tert-butoxy)carbonyl]amino]propanoic acid methyl ester hydrochloride |
| (S)-Methyl 3-aMino-2-((tert-butoxycarbonyl)aMino)propanoate hydrochloride |