3,3,4,4,5,5,6,6,7,7,8,8-Dodecafluoro-1,10-diiododecane structure
|
Common Name | 3,3,4,4,5,5,6,6,7,7,8,8-Dodecafluoro-1,10-diiododecane | ||
|---|---|---|---|---|
| CAS Number | 1813-83-8 | Molecular Weight | 609.96000 | |
| Density | 2.054g/cm3 | Boiling Point | 301.7ºC at 760 mmHg | |
| Molecular Formula | C10H8F12I2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136ºC | |
| Name | 3,3,4,4,5,5,6,6,7,7,8,8-Dodecafluoro-1,10-diiododecane |
|---|---|
| Synonym | More Synonyms |
| Density | 2.054g/cm3 |
|---|---|
| Boiling Point | 301.7ºC at 760 mmHg |
| Molecular Formula | C10H8F12I2 |
| Molecular Weight | 609.96000 |
| Flash Point | 136ºC |
| Exact Mass | 609.85200 |
| LogP | 6.44840 |
| Vapour Pressure | 0.00186mmHg at 25°C |
| Index of Refraction | 1.425 |
| InChIKey | FPHLHLVYLCQBKG-UHFFFAOYSA-N |
| SMILES | FC(F)(CCI)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCI |
|
~93%
3,3,4,4,5,5,6,6... CAS#:1813-83-8 |
| Literature: Urata, Hisao; Kinoshita, Yoshihiro; Asanuma, Tatsuya; Kosukegawa, Osamu; Fuchikami, Takamasa Journal of Organic Chemistry, 1991 , vol. 56, # 16 p. 4996 - 4999 |
| heptadecafluorodecyl methacrylate |
| 3,3,4,4,5,5,6,6,7,7,8,8-Dodecafluor-1,10-diiod-decan |
| Perfluorooctyl-ethylene methycrylate |
| 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-heptadecafluorodecyl methacrylate |
| 1h,1h,2h,2h-perfluorodecyl methacrylate |
| 1,10-diiodo-3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodecane |
| 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl methacrylate |
| 1H,1H,2H,2H-heptadecafluorodecyl methacrylate |
| 1,10-diiodo-1H,1H,2H,2H,9H,9H,10H,10H-perfluorodecane |
| 3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-1,10-diiodo-decane |