Xylyl dibutylbenzofuranone structure
|
Common Name | Xylyl dibutylbenzofuranone | ||
|---|---|---|---|---|
| CAS Number | 181314-48-7 | Molecular Weight | 350.49400 | |
| Density | 1.043g/cm3 | Boiling Point | 404.998ºC at 760 mmHg | |
| Molecular Formula | C24H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.776ºC | |
| Name | Xylyl dibutylbenzofuranone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.043g/cm3 |
|---|---|
| Boiling Point | 404.998ºC at 760 mmHg |
| Molecular Formula | C24H30O2 |
| Molecular Weight | 350.49400 |
| Flash Point | 170.776ºC |
| Exact Mass | 350.22500 |
| PSA | 26.30000 |
| LogP | 6.50580 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | BNAOQKULFPHAHL-UHFFFAOYSA-N |
| SMILES | CCCCc1c(-c2ccc(C)cc2C)ccc2c1C(CCCC)C(=O)O2 |
| 2(3H)-Benzofuranone,5,7-bis(1,1-dimethylethyl)-3-hydroxy-,reaction products with o-xylene |
| 3,4-Dibutyl-5-(2,4-dimethylphenyl)benzofuran-2(3H)-one |
| Reaction product of 5,7-bis(1,1-dimetylethyl)-3-hydroxy-2(3H)-benzofuranone with o-xylene |
| HP-136 |