Carbanilic acid,5-fluoro-2-methoxy-, isopropyl ester (8CI) structure
|
Common Name | Carbanilic acid,5-fluoro-2-methoxy-, isopropyl ester (8CI) | ||
|---|---|---|---|---|
| CAS Number | 1815-65-2 | Molecular Weight | 227.23200 | |
| Density | 1.192g/cm3 | Boiling Point | 267.1ºC at 760 mmHg | |
| Molecular Formula | C11H14FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 115.4ºC | |
| Name | 5-fluoro-2-methoxy-, isopropyl ester (8CI)Carbanilic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.192g/cm3 |
|---|---|
| Boiling Point | 267.1ºC at 760 mmHg |
| Molecular Formula | C11H14FNO3 |
| Molecular Weight | 227.23200 |
| Flash Point | 115.4ºC |
| Exact Mass | 227.09600 |
| PSA | 47.56000 |
| LogP | 2.86420 |
| Vapour Pressure | 0.0083mmHg at 25°C |
| Index of Refraction | 1.522 |
| InChIKey | RRTGDPAQWRNKQT-UHFFFAOYSA-N |
| SMILES | COc1ccc(F)cc1NC(=O)OC(C)C |
|
~%
Carbanilic acid... CAS#:1815-65-2 |
| Literature: Finger,G.C. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 572 - 573 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| N-(Aethylmercapto-[1,3,4]thiadiazol-2-yl)-acetamid |
| N-[5-(ethylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide |
| N-<5-Fluor-2-methoxy-phenyl>-carbamidsaeureaethylester |
| N-(ethylmercapto-[1,3,4]thiadiazol-2-yl)-acetamide |
| N-<5-Fluor-2-methoxy-phenyl>-carbamidsaeureisopropylester |
| 2-Acetylamino-5-ethylthio-1,3,4-thiadiazole |