1,1-diphenyl-3-propan-2-ylurea
Modify Date: 2025-08-24 19:56:28
1,1-diphenyl-3-propan-2-ylurea structure
|
Common Name | 1,1-diphenyl-3-propan-2-ylurea | ||
|---|---|---|---|---|
| CAS Number | 18168-00-8 | Molecular Weight | 254.32700 | |
| Density | 1.106g/cm3 | Boiling Point | 427.8ºC at 760mmHg | |
| Molecular Formula | C16H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.5ºC | |
| Name | 1,1-diphenyl-3-propan-2-ylurea |
|---|
| Density | 1.106g/cm3 |
|---|---|
| Boiling Point | 427.8ºC at 760mmHg |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.32700 |
| Flash Point | 212.5ºC |
| Exact Mass | 254.14200 |
| PSA | 32.34000 |
| LogP | 4.33360 |
| Vapour Pressure | 1.59E-07mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | FFGAIZYREGLOLX-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)N(c1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |