1-methyl-4-(1,3,4,4-tetrachloro-2-nitrobuta-1,3-dienyl)sulfanylbenzene structure
|
Common Name | 1-methyl-4-(1,3,4,4-tetrachloro-2-nitrobuta-1,3-dienyl)sulfanylbenzene | ||
|---|---|---|---|---|
| CAS Number | 181716-56-3 | Molecular Weight | 359.05600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H7Cl4NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-4-(1,3,4,4-tetrachloro-2-nitrobuta-1,3-dienyl)sulfanylbenzene |
|---|
| Molecular Formula | C11H7Cl4NO2S |
|---|---|
| Molecular Weight | 359.05600 |
| Exact Mass | 356.89500 |
| PSA | 71.12000 |
| LogP | 6.18040 |
| InChIKey | SXDOQPILVMKHBZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(SC(Cl)=C(C(Cl)=C(Cl)Cl)[N+](=O)[O-])cc1 |
|
~87%
1-methyl-4-(1,3... CAS#:181716-56-3 |
| Literature: Ibis, Cemil; Goekmen, Zeliha; Bozkurt, Nihal Yilmaz Phosphorus, Sulfur and Silicon and the Related Elements, 2002 , vol. 177, # 12 p. 2907 - 2914 |