2-acetyl-N,N-di(propan-2-yl)naphthalene-1-carboxamide structure
|
Common Name | 2-acetyl-N,N-di(propan-2-yl)naphthalene-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 181775-45-1 | Molecular Weight | 297.39100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-acetyl-N,N-di(propan-2-yl)naphthalene-1-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H23NO2 |
|---|---|
| Molecular Weight | 297.39100 |
| Exact Mass | 297.17300 |
| PSA | 37.38000 |
| LogP | 4.30140 |
| InChIKey | VAQNUBBZKOZSNT-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2ccccc2c1C(=O)N(C(C)C)C(C)C |
|
~99%
2-acetyl-N,N-di... CAS#:181775-45-1 |
| Literature: Clayden, Jonathan; Westlund, Neil; Beddocs, Roy L.; Helliwell, Madeleine Journal of the Chemical Society, Perkin Transactions 1, 2000 , # 9 p. 1351 - 1361 |
| 2-Acetyl-N,N-diisopropyl-1-naphthamide |