4-Isobutoxybenzylamine N-Phenyl Formate
Modify Date: 2026-09-28 09:21:57
4-Isobutoxybenzylamine N-Phenyl Formate structure
|
Common Name | 4-Isobutoxybenzylamine N-Phenyl Formate | ||
|---|---|---|---|---|
| CAS Number | 1817844-09-9 | Molecular Weight | 299.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Isobutoxybenzylamine N-Phenyl Formate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H21NO3 |
|---|---|
| Molecular Weight | 299.4 |
| InChIKey | UNIXIBUAGDSVOK-UHFFFAOYSA-N |
| SMILES | CC(C)COc1ccc(CNC(=O)Oc2ccccc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-Isobutoxybenzylamine N-Phenyl Formate? |
| A: InChIKey of 4-Isobutoxybenzylamine N-Phenyl Formate is UNIXIBUAGDSVOK-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-Isobutoxybenzylamine N-Phenyl Formate? |
| A: SMILES notation of 4-Isobutoxybenzylamine N-Phenyl Formate is CC(C)COc1ccc(CNC(=O)Oc2ccccc2)cc1. |
| Q: What is the Chinese name of 1817844-09-9? |
| A: Chinese name of 1817844-09-9 is 1817844-09-9. |
| Q: What is the molecular weight of 4-Isobutoxybenzylamine N-Phenyl Formate? |
| A: Molecular weight of 4-Isobutoxybenzylamine N-Phenyl Formate is 299.4. |
| Q: What is the molecular formula of 4-Isobutoxybenzylamine N-Phenyl Formate? |
| A: Molecular formula of 4-Isobutoxybenzylamine N-Phenyl Formate is C18H21NO3. |
| Q: What is the English name of 4-Isobutoxybenzylamine N-Phenyl Formate? |
| A: The English name of 4-Isobutoxybenzylamine N-Phenyl Formate is 4-Isobutoxybenzylamine N-Phenyl Formate. |
| Q: What is the CAS number of 4-Isobutoxybenzylamine N-Phenyl Formate? |
| A: CAS number of 4-Isobutoxybenzylamine N-Phenyl Formate is 1817844-09-9. |