1H-Purine-2,6 (3H,7H)-dione, 1,3,7-trimethyl-8-propoxy- structure
|
Common Name | 1H-Purine-2,6 (3H,7H)-dione, 1,3,7-trimethyl-8-propoxy- | ||
|---|---|---|---|---|
| CAS Number | 1818-66-2 | Molecular Weight | 252.27000 | |
| Density | 1.34g/cm3 | Boiling Point | 412.4ºC at 760 mmHg | |
| Molecular Formula | C11H16N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.2ºC | |
| Name | 1,3,7-trimethyl-8-propoxypurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 412.4ºC at 760 mmHg |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27000 |
| Flash Point | 203.2ºC |
| Exact Mass | 252.12200 |
| PSA | 71.05000 |
| Vapour Pressure | 5.18E-07mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | GWQATCITTRTTPB-UHFFFAOYSA-N |
| SMILES | CCCOc1nc2c(c(=O)n(C)c(=O)n2C)n1C |
|
~%
1H-Purine-2,6 (... CAS#:1818-66-2 |
| Literature: Huston; Allen Journal of the American Chemical Society, 1934 , vol. 56, p. 1358 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 8-Propyloxycaffeine |
| 1,3,7-Trimethyl-8-propoxy-3,7-dihydro-purin-2,6-dion |
| UNII-P5V084Y5X1 |
| HMS2884M20 |
| 1,3,7-trimethyl-8-propoxy-3,7-dihydro-purine-2,6-dione |
| 8-Propoxy-caffein |