Ethanone, 1-(2,5-dimethylphenyl)-2,2,2-trifluoro- (9CI) structure
|
Common Name | Ethanone, 1-(2,5-dimethylphenyl)-2,2,2-trifluoro- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 181828-02-4 | Molecular Weight | 202.17300 | |
| Density | 1.189g/cm3 | Boiling Point | 215.6ºC at 760mmHg | |
| Molecular Formula | C10H9F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 96ºC | |
| Name | 1-(2,5-Dimethylphenyl)-2,2,2-trifluoroethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.189g/cm3 |
|---|---|
| Boiling Point | 215.6ºC at 760mmHg |
| Molecular Formula | C10H9F3O |
| Molecular Weight | 202.17300 |
| Flash Point | 96ºC |
| Exact Mass | 202.06100 |
| PSA | 17.07000 |
| LogP | 3.04840 |
| Vapour Pressure | 0.147mmHg at 25°C |
| Index of Refraction | 1.458 |
| InChIKey | BFBOWVWCPWSAGW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c(C(=O)C(F)(F)F)c1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-(2,5-dimethylphenyl)-2,2,2-trifluoroethan-1-one |
| 2',5'-dimethyl-2,2,2-trifluoroacetophenone |
| ethanone,1-(2,5-dimethylphenyl)-2,2,2-trifluoro |
| 1-(2,5-dimethyl-phenyl)-2,2,2-trifluoro-ethanone |