S-acetyl-PEG3-Boc structure
|
Common Name | S-acetyl-PEG3-Boc | ||
|---|---|---|---|---|
| CAS Number | 1818294-27-7 | Molecular Weight | 336.444 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 413.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C15H28O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.4±14.0 °C | |
Use of S-acetyl-PEG3-BocS-acetyl-PEG3-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | S-acetyl-PEG3-t-butyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | S-acetyl-PEG3-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 413.9±35.0 °C at 760 mmHg |
| Molecular Formula | C15H28O6S |
| Molecular Weight | 336.444 |
| Flash Point | 188.4±14.0 °C |
| Exact Mass | 336.160645 |
| LogP | 1.52 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.471 |
| InChIKey | JTUABWSFWXGORZ-UHFFFAOYSA-N |
| SMILES | CC(=O)SCCOCCOCCOCCC(=O)OC(C)(C)C |
| 2-Methyl-2-propanyl 2-oxo-6,9,12-trioxa-3-thiapentadecan-15-oate |
| MFCD22574782 |
| 6,9,12-Trioxa-3-thiapentadecan-15-oic acid, 2-oxo-, 1,1-dimethylethyl ester |