Serotonin glucuronide structure
|
Common Name | Serotonin glucuronide | ||
|---|---|---|---|---|
| CAS Number | 18186-43-1 | Molecular Weight | 352.33900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Serotonin glucuronideSerotonin glucuronide is the product of Serotonin glucuronidation[1]. |
| Name | Serotonin β-D-Glucuronide |
|---|---|
| Synonym | More Synonyms |
| Description | Serotonin glucuronide is the product of Serotonin glucuronidation[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C16H20N2O7 |
|---|---|
| Molecular Weight | 352.33900 |
| Exact Mass | 352.12700 |
| PSA | 158.26000 |
| InChIKey | QALKNDMLQRCLGT-JHZZJYKESA-N |
| SMILES | NCCc1c[nH]c2ccc(OC3OC(C(=O)O)C(O)C(O)C3O)cc12 |
| (2S,3S,4S,5R,6S)-6-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |