5-Bromo-2-isobutyl-5-nitro-1,3,2-dioxaborinane
Modify Date: 2026-07-10 16:43:26
5-Bromo-2-isobutyl-5-nitro-1,3,2-dioxaborinane structure
|
Common Name | 5-Bromo-2-isobutyl-5-nitro-1,3,2-dioxaborinane | ||
|---|---|---|---|---|
| CAS Number | 182004-80-4 | Molecular Weight | 265.90 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H13BBrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Bromo-2-isobutyl-5-nitro-1,3,2-dioxaborinane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H13BBrNO4 |
|---|---|
| Molecular Weight | 265.90 |
| InChIKey | JQWPBBRKWYTROH-UHFFFAOYSA-N |
| SMILES | CC(C)CB1OCC(Br)([N+](=O)[O-])CO1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-Bromo-2-isobutyl-5-nitro-1,3,2-dioxaborinane? |
| A: InChIKey of 5-Bromo-2-isobutyl-5-nitro-1,3,2-dioxaborinane is JQWPBBRKWYTROH-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 182004-80-4? |
| A: Chinese name of 182004-80-4 is 182004-80-4. |
| Q: What is the molecular weight of 5-Bromo-2-isobutyl-5-nitro-1,3,2-dioxaborinane? |
| A: Molecular weight of 5-Bromo-2-isobutyl-5-nitro-1,3,2-dioxaborinane is 265.90. |
| Q: What is the CAS number of 5-Bromo-2-isobutyl-5-nitro-1,3,2-dioxaborinane? |
| A: CAS number of 5-Bromo-2-isobutyl-5-nitro-1,3,2-dioxaborinane is 182004-80-4. |
| Q: What is the English name of 5-Bromo-2-isobutyl-5-nitro-1,3,2-dioxaborinane? |
| A: The English name of 5-Bromo-2-isobutyl-5-nitro-1,3,2-dioxaborinane is 5-Bromo-2-isobutyl-5-nitro-1,3,2-dioxaborinane. |
| Q: What is the SMILES notation of 5-Bromo-2-isobutyl-5-nitro-1,3,2-dioxaborinane? |
| A: SMILES notation of 5-Bromo-2-isobutyl-5-nitro-1,3,2-dioxaborinane is CC(C)CB1OCC(Br)([N+](=O)[O-])CO1. |
| Q: What is the molecular formula of 5-Bromo-2-isobutyl-5-nitro-1,3,2-dioxaborinane? |
| A: Molecular formula of 5-Bromo-2-isobutyl-5-nitro-1,3,2-dioxaborinane is C7H13BBrNO4. |