copper(1+),1,2,3,4,5-pentafluorobenzene-6-ide structure
|
Common Name | copper(1+),1,2,3,4,5-pentafluorobenzene-6-ide | ||
|---|---|---|---|---|
| CAS Number | 18206-43-4 | Molecular Weight | 230.60200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6CuF5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | copper(1+),1,2,3,4,5-pentafluorobenzene-6-ide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6CuF5 |
|---|---|
| Molecular Weight | 230.60200 |
| Exact Mass | 229.92200 |
| LogP | 2.95530 |
| InChIKey | GESZGOQOLBACSZ-UHFFFAOYSA-N |
| SMILES | Fc1[c-]c(F)c(F)c(F)c1F.[Cu+] |
|
~%
copper(1+),1,2,... CAS#:18206-43-4 |
| Literature: THE UNIVERSITY OF HOUSTON SYSTEM Patent: US2009/76266 A1, 2009 ; Location in patent: Page/Page column 20 ; |
|
~%
copper(1+),1,2,... CAS#:18206-43-4 |
| Literature: Gmelin Handbook: F: PerFHalOrg.4, 2.2.4, page 68 - 115 |
| Pentafluorphenylcupfer |
| Pentafluorphenylkupfer |
| pentafluorophenyl copper |
| 2,3,4,5,6-pentafluorophenyl copper |