1,3-Diethyl 2-(6-chloro-3-methoxy-2-pyridinyl)propanedioate
Modify Date: 2025-09-05 18:52:04
1,3-Diethyl 2-(6-chloro-3-methoxy-2-pyridinyl)propanedioate structure
|
Common Name | 1,3-Diethyl 2-(6-chloro-3-methoxy-2-pyridinyl)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 1820896-72-7 | Molecular Weight | 301.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-Diethyl 2-(6-chloro-3-methoxy-2-pyridinyl)propanedioate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16ClNO5 |
|---|---|
| Molecular Weight | 301.72 |
| InChIKey | KOESWHSONUJZNA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)c1nc(Cl)ccc1OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1,3-Diethyl 2-(6-chloro-3-methoxy-2-pyridinyl)propanedioate? |
| A: InChIKey of 1,3-Diethyl 2-(6-chloro-3-methoxy-2-pyridinyl)propanedioate is KOESWHSONUJZNA-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1,3-Diethyl 2-(6-chloro-3-methoxy-2-pyridinyl)propanedioate? |
| A: Molecular formula of 1,3-Diethyl 2-(6-chloro-3-methoxy-2-pyridinyl)propanedioate is C13H16ClNO5. |
| Q: What is the English name of 1,3-Diethyl 2-(6-chloro-3-methoxy-2-pyridinyl)propanedioate? |
| A: The English name of 1,3-Diethyl 2-(6-chloro-3-methoxy-2-pyridinyl)propanedioate is 1,3-Diethyl 2-(6-chloro-3-methoxy-2-pyridinyl)propanedioate. |
| Q: What is the CAS number of 1,3-Diethyl 2-(6-chloro-3-methoxy-2-pyridinyl)propanedioate? |
| A: CAS number of 1,3-Diethyl 2-(6-chloro-3-methoxy-2-pyridinyl)propanedioate is 1820896-72-7. |
| Q: What is the molecular weight of 1,3-Diethyl 2-(6-chloro-3-methoxy-2-pyridinyl)propanedioate? |
| A: Molecular weight of 1,3-Diethyl 2-(6-chloro-3-methoxy-2-pyridinyl)propanedioate is 301.72. |
| Q: What is the SMILES notation of 1,3-Diethyl 2-(6-chloro-3-methoxy-2-pyridinyl)propanedioate? |
| A: SMILES notation of 1,3-Diethyl 2-(6-chloro-3-methoxy-2-pyridinyl)propanedioate is CCOC(=O)C(C(=O)OCC)c1nc(Cl)ccc1OC. |
| Q: What is the Chinese name of 1820896-72-7? |
| A: Chinese name of 1820896-72-7 is 1820896-72-7. |