1,3-dibromo-5-tert-butyl-2-[diazo-(2,6-dibromo-4-tert-butylphenyl)methyl]benzene structure
|
Common Name | 1,3-dibromo-5-tert-butyl-2-[diazo-(2,6-dibromo-4-tert-butylphenyl)methyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 182170-73-6 | Molecular Weight | 622.02900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22Br4N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-dibromo-5-tert-butyl-2-[diazo-(2,6-dibromo-4-tert-butylphenyl)methyl]benzene |
|---|
| Molecular Formula | C21H22Br4N2 |
|---|---|
| Molecular Weight | 622.02900 |
| Exact Mass | 617.85200 |
| PSA | 37.39000 |
| LogP | 8.47986 |
| InChIKey | XIUOJSITQQEKNC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(Br)c(C(=[N+]=[N-])c2c(Br)cc(C(C)(C)C)cc2Br)c(Br)c1 |
|
~7%
1,3-dibromo-5-t... CAS#:182170-73-6 |
| Literature: Tomioka, Hideo; Watanabe, Tetsuya; Hattori, Makoto; Nomura, Naoki; Hirai, Katsuyuki Journal of the American Chemical Society, 2002 , vol. 124, # 3 p. 474 - 482 |