2-Naphthalenecarboxylic acid, 5,6-dihydroxy- (9CI) structure
|
Common Name | 2-Naphthalenecarboxylic acid, 5,6-dihydroxy- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 182205-62-5 | Molecular Weight | 204.17900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,6-dihydroxynaphthalene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H8O4 |
|---|---|
| Molecular Weight | 204.17900 |
| Exact Mass | 204.04200 |
| PSA | 77.76000 |
| LogP | 1.94920 |
| InChIKey | ICGAFQWZWKIUMN-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2c(O)c(O)ccc2c1 |
|
~83%
2-Naphthaleneca... CAS#:182205-62-5 |
| Literature: Zhao, He; Neamati, Nouri; Mazumder, Abhijit; Sunder, Sanjay; Pommier, Yves; Burke Jr., Terrence R. Journal of Medicinal Chemistry, 1997 , vol. 40, # 8 p. 1186 - 1194 |
|
Name: Inhibition of HIV-1 integrase-mediated 3'-processing
Source: ChEMBL
Target: Integrase
External Id: CHEMBL702114
|
|
Name: Inhibition of HIV-1 integrase-mediated strand transfer
Source: ChEMBL
Target: Integrase
External Id: CHEMBL701109
|
| 5,6-Dihydroxy-2-naphthoic acid |