2-Naphthalenecarboxylic acid, 5,6-dihydroxy- (9CI)
2-Naphthalenecarboxylic acid, 5,6-dihydroxy- (9CI) structure
|
Common Name | 2-Naphthalenecarboxylic acid, 5,6-dihydroxy- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 182205-62-5 | Molecular Weight | 204.17900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,6-dihydroxynaphthalene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H8O4 |
|---|---|
| Molecular Weight | 204.17900 |
| Exact Mass | 204.04200 |
| PSA | 77.76000 |
| LogP | 1.94920 |
| InChIKey | ICGAFQWZWKIUMN-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2c(O)c(O)ccc2c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~83%
2-Naphthaleneca... CAS#:182205-62-5 |
| Literature: Zhao, He; Neamati, Nouri; Mazumder, Abhijit; Sunder, Sanjay; Pommier, Yves; Burke Jr., Terrence R. Journal of Medicinal Chemistry, 1997 , vol. 40, # 8 p. 1186 - 1194 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of HIV-1 integrase-mediated 3'-processing
Source: ChEMBL
Target: Integrase
External Id: CHEMBL702114
|
|
Name: Inhibition of HIV-1 integrase-mediated strand transfer
Source: ChEMBL
Target: Integrase
External Id: CHEMBL701109
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5,6-Dihydroxy-2-naphthoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 5,6-dihydroxynaphthalene-2-carboxylic acid? |
| A: SMILES notation of 5,6-dihydroxynaphthalene-2-carboxylic acid is O=C(O)c1ccc2c(O)c(O)ccc2c1. |
| Q: What is the English name of 5,6-dihydroxynaphthalene-2-carboxylic acid? |
| A: The English name of 5,6-dihydroxynaphthalene-2-carboxylic acid is 5,6-dihydroxynaphthalene-2-carboxylic acid. |
| Q: What is the polar surface area (PSA) of 5,6-dihydroxynaphthalene-2-carboxylic acid? |
| A: Polar surface area (PSA) of 5,6-dihydroxynaphthalene-2-carboxylic acid is 77.76000. |
| Q: What is the molecular formula of 5,6-dihydroxynaphthalene-2-carboxylic acid? |
| A: Molecular formula of 5,6-dihydroxynaphthalene-2-carboxylic acid is C11H8O4. |
| Q: What is the InChIKey of 5,6-dihydroxynaphthalene-2-carboxylic acid? |
| A: InChIKey of 5,6-dihydroxynaphthalene-2-carboxylic acid is ICGAFQWZWKIUMN-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 182205-62-5? |
| A: Chinese name of 182205-62-5 is 182205-62-5. |
| Q: What is the LogP of 5,6-dihydroxynaphthalene-2-carboxylic acid? |
| A: LogP of 5,6-dihydroxynaphthalene-2-carboxylic acid is 1.94920. |
| Q: What is the CAS number of 5,6-dihydroxynaphthalene-2-carboxylic acid? |
| A: CAS number of 5,6-dihydroxynaphthalene-2-carboxylic acid is 182205-62-5. |
| Q: What is the molecular weight of 5,6-dihydroxynaphthalene-2-carboxylic acid? |
| A: Molecular weight of 5,6-dihydroxynaphthalene-2-carboxylic acid is 204.17900. |
| Q: What English synonyms does 5,6-dihydroxynaphthalene-2-carboxylic acid have? |
| A: English synonyms of 5,6-dihydroxynaphthalene-2-carboxylic acid: 5,6-Dihydroxy-2-naphthoic acid. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |