1-Benzyl-4-benzyloxycarbonylaminopiperidine structure
|
Common Name | 1-Benzyl-4-benzyloxycarbonylaminopiperidine | ||
|---|---|---|---|---|
| CAS Number | 182223-53-6 | Molecular Weight | 324.41700 | |
| Density | 1.158g/cm3 | Boiling Point | 475.75ºC at 760 mmHg | |
| Molecular Formula | C20H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.525ºC | |
| Name | benzyl N-(1-benzylpiperidin-4-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 475.75ºC at 760 mmHg |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.41700 |
| Flash Point | 241.525ºC |
| Exact Mass | 324.18400 |
| PSA | 45.06000 |
| LogP | 3.71970 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | VZHJWMOVSNSVSX-UHFFFAOYSA-N |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)OCc1ccccc1 |
| HS Code | 2933399090 |
|---|
|
~65%
1-Benzyl-4-benz... CAS#:182223-53-6 |
| Literature: Schaus, John M.; Thompson, Dennis C.; Bloomquist, William E.; Susemichel, Alice D.; Calligaro, David O.; Cohen, Marlene L. Journal of Medicinal Chemistry, 1998 , vol. 41, # 11 p. 1943 - 1955 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| [1-(Benzyl)-4-piperidinyl]carbamic Acid Benzyl Ester |
| [1-(Phenylmethyl)-4-piperidinyl]carbamic Acid Phenylmethyl Ester |
| 1-BENZYL-4-BENZYLOXYCARBONYLAMINOPIPERIDINE |
| N-(Benzyloxycarbonyl)-1-benzylpiperidin-4-ylamine |
| Benzyl (1-Benzylpiperidin-4-yl)carbamate |