3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane
![3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane Structure](https://image.chemsrc.com/caspic/083/18225-19-9.png)
3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane structure
|
Common Name | 3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane | ||
|---|---|---|---|---|
| CAS Number | 18225-19-9 | Molecular Weight | 203.31100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H17NO3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H17NO3Si |
|---|---|
| Molecular Weight | 203.31100 |
| Exact Mass | 203.09800 |
| PSA | 30.93000 |
| LogP | 0.26050 |
| InChIKey | SJSYJCKBYWTBQM-UHFFFAOYSA-N |
| SMILES | CC1CN2CCO[Si](C)(OCC2)O1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3,5-dimethyl-4,... CAS#:18225-19-9 |
| Literature: Frye,C.L. et al. Journal of the American Chemical Society, 1961 , vol. 83, p. 996 - 997 |
![2-Propanol,1-[bis(2-hydroxyethyl)amino] structure](https://image.chemsrc.com/caspic/180/6712-98-7.png)
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,3-dimethylsilatrane |
| 3.5-Dimethyl-triptych-siloxazolidin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane? |
| A: Polar surface area (PSA) of 3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane is 30.93000. |
| Q: What is the CAS number of 3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane? |
| A: CAS number of 3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane is 18225-19-9. |
| Q: What is the Chinese name of 18225-19-9? |
| A: Chinese name of 18225-19-9 is 18225-19-9. |
| Q: What is the LogP of 3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane? |
| A: LogP of 3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane is 0.26050. |
| Q: What is the SMILES notation of 3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane? |
| A: SMILES notation of 3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane is CC1CN2CCO[Si](C)(OCC2)O1. |
| Q: What is the English name of 3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane? |
| A: The English name of 3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane is 3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane. |
| Q: What is the molecular weight of 3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane? |
| A: Molecular weight of 3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane is 203.31100. |
| Q: What is the molecular formula of 3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane? |
| A: Molecular formula of 3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane is C8H17NO3Si. |
| Q: What English synonyms does 3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane have? |
| A: English synonyms of 3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane: 1,3-dimethylsilatrane, 3.5-Dimethyl-triptych-siloxazolidin. |
| Q: What is the InChIKey of 3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane? |
| A: InChIKey of 3,5-dimethyl-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane is SJSYJCKBYWTBQM-UHFFFAOYSA-N. |